C12H21NO4 — CID 115536035
3-O-ethyl 1-O-propan-2-yl (3S)-piperidine-1,3-dicarboxylate (PubChem CID 115536035) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 3-O-ethyl 1-O-propan-2-yl (3S)-piperidine-1,3-dicarboxylate.
| Compound Name | 3-O-ethyl 1-O-propan-2-yl (3S)-piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 115536035 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-O-ethyl 1-O-propan-2-yl (3S)-piperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)OC(C)C)C1 |
| InChI | InChI=1S/C12H21NO4/c1-4-16-11(14)10-6-5-7-13(8-10)12(15)17-9(2)3/h9-10H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | TYLKGJHPMMSLPP-JTQLQIEISA-N |
| XLogP | 1.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |