C13H21N3O4S — CID 115536277
methyl (3S)-1-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 115536277) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is methyl (3S)-1-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 115536277 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl (3S)-1-(1-ethyl-2-methylimidazol-4-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | CCn1cc(S(=O)(=O)N2CCC[C@H](C(=O)OC)C2)nc1C |
| InChI | InChI=1S/C13H21N3O4S/c1-4-15-9-12(14-10(15)2)21(18,19)16-7-5-6-11(8-16)13(17)20-3/h9,11H,4-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | FHDLZGUYWPCEKE-NSHDSACASA-N |
| XLogP | 0.79 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |