C15H23N3O3 — CID 115537166
methyl 3-[4-[(2-methoxy-3-pyridinyl)methyl]piperazin-1-yl]propanoate (PubChem CID 115537166) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 3-[4-[(2-methoxy-3-pyridinyl)methyl]piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[4-[(2-methoxy-3-pyridinyl)methyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 115537166 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | methyl 3-[4-[(2-methoxy-3-pyridinyl)methyl]piperazin-1-yl]propanoate |
| SMILES | COC(=O)CCN1CCN(Cc2cccnc2OC)CC1 |
| InChI | InChI=1S/C15H23N3O3/c1-20-14(19)5-7-17-8-10-18(11-9-17)12-13-4-3-6-16-15(13)21-2/h3-4,6H,5,7-12H2,1-2H3 |
| InChIKey | YRYLIHMAURHNQX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |