C22H32N4O3S — CID 11553795
ethyl 3-[(2-benzyl-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioyl)amino]butanoate (PubChem CID 11553795) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is ethyl 3-[(2-benzyl-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioyl)amino]butanoate.
| Compound Name | ethyl 3-[(2-benzyl-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioyl)amino]butanoate |
|---|---|
| PubChem CID | 11553795 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | ethyl 3-[(2-benzyl-4-methyl-3-oxo-1,4,8-triazaspiro[4.5]decane-8-carbothioyl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)NC(=S)N1CCC2(CC1)NC(Cc1ccccc1)C(=O)N2C |
| InChI | InChI=1S/C22H32N4O3S/c1-4-29-19(27)14-16(2)23-21(30)26-12-10-22(11-13-26)24-18(20(28)25(22)3)15-17-8-6-5-7-9-17/h5-9,16,18,24H,4,10-15H2,1-3H3,(H,23,30) |
| InChIKey | BXGBWDKJARXZJA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|