C24H25F3O4 — CID 11553830
4-[5,5,8,8-tetramethyl-3-(2,2,2-trifluoroethoxy)-6,7-dihydronaphthalene-2-carbonyl]benzoic acid (PubChem CID 11553830) has the molecular formula C24H25F3O4 and a molecular weight of 434.45 g/mol. Its IUPAC name is 4-[5,5,8,8-tetramethyl-3-(2,2,2-trifluoroethoxy)-6,7-dihydronaphthalene-2-carbonyl]benzoic acid.
| Compound Name | 4-[5,5,8,8-tetramethyl-3-(2,2,2-trifluoroethoxy)-6,7-dihydronaphthalene-2-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 11553830 |
| Molecular Formula | C24H25F3O4 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-[5,5,8,8-tetramethyl-3-(2,2,2-trifluoroethoxy)-6,7-dihydronaphthalene-2-carbonyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)c3ccc(C(=O)O)cc3)c(OCC(F)(F)F)cc21 |
| InChI | InChI=1S/C24H25F3O4/c1-22(2)9-10-23(3,4)18-12-19(31-13-24(25,26)27)16(11-17(18)22)20(28)14-5-7-15(8-6-14)21(29)30/h5-8,11-12H,9-10,13H2,1-4H3,(H,29,30) |
| InChIKey | HCCZOIXYYAJXSJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |