C14H18N2O4S — CID 115539478
tert-butyl (2R)-2-(cyanomethylsulfonylamino)-2-phenylacetate (PubChem CID 115539478) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-(cyanomethylsulfonylamino)-2-phenylacetate.
| Compound Name | tert-butyl (2R)-2-(cyanomethylsulfonylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 115539478 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | tert-butyl (2R)-2-(cyanomethylsulfonylamino)-2-phenylacetate |
| SMILES | CC(C)(C)OC(=O)[C@H](NS(=O)(=O)CC#N)c1ccccc1 |
| InChI | InChI=1S/C14H18N2O4S/c1-14(2,3)20-13(17)12(11-7-5-4-6-8-11)16-21(18,19)10-9-15/h4-8,12,16H,10H2,1-3H3/t12-/m1/s1 |
| InChIKey | CLAJDVUWOGZGEX-GFCCVEGCSA-N |
| XLogP | 1.51 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |