C21H18FNO9 — CID 11554142
(2S,3S,4S,5R,6S)-6-[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 11554142) has the molecular formula C21H18FNO9 and a molecular weight of 447.37 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 11554142 |
| Molecular Formula | C21H18FNO9 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[4-(7-ethenyl-5-hydroxy-1,3-benzoxazol-2-yl)-2-fluorophenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C=Cc1cc(O)cc2nc(-c3ccc(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)c(F)c3)oc12 |
| InChI | InChI=1S/C21H18FNO9/c1-2-8-5-10(24)7-12-17(8)31-19(23-12)9-3-4-13(11(22)6-9)30-21-16(27)14(25)15(26)18(32-21)20(28)29/h2-7,14-16,18,21,24-27H,1H2,(H,28,29)/t14-,15-,16+,18-,21+/m0/s1 |
| InChIKey | NMYOEDLGRKZNAE-DQSYDGHTSA-N |
| XLogP | 1.25 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |