C15H15N3O2S — CID 115541794
1-(1-thiophen-2-ylbutyl)benzotriazole-4-carboxylic acid (PubChem CID 115541794) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1-(1-thiophen-2-ylbutyl)benzotriazole-4-carboxylic acid.
| Compound Name | 1-(1-thiophen-2-ylbutyl)benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115541794 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-(1-thiophen-2-ylbutyl)benzotriazole-4-carboxylic acid |
| SMILES | CCCC(c1cccs1)n1nnc2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C15H15N3O2S/c1-2-5-11(13-8-4-9-21-13)18-12-7-3-6-10(15(19)20)14(12)16-17-18/h3-4,6-9,11H,2,5H2,1H3,(H,19,20) |
| InChIKey | CXTUTVJYVTXRFR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |