C26H23N3O5S — CID 1155436
methyl 4-[[2-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]benzoate (PubChem CID 1155436) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is methyl 4-[[2-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 1155436 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | methyl 4-[[2-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOc1ccccc1-n1c(SCC(=O)Nc2ccc(C(=O)OC)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H23N3O5S/c1-3-34-22-11-7-6-10-21(22)29-24(31)19-8-4-5-9-20(19)28-26(29)35-16-23(30)27-18-14-12-17(13-15-18)25(32)33-2/h4-15H,3,16H2,1-2H3,(H,27,30) |
| InChIKey | ZUYQVSVZDJWUMO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |