C14H13N3O4 — CID 115543827
1-(1-methyl-2,6-dioxopiperidin-3-yl)benzimidazole-4-carboxylic acid (PubChem CID 115543827) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-(1-methyl-2,6-dioxopiperidin-3-yl)benzimidazole-4-carboxylic acid.
| Compound Name | 1-(1-methyl-2,6-dioxopiperidin-3-yl)benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115543827 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-(1-methyl-2,6-dioxopiperidin-3-yl)benzimidazole-4-carboxylic acid |
| SMILES | CN1C(=O)CCC(n2cnc3c(C(=O)O)cccc32)C1=O |
| InChI | InChI=1S/C14H13N3O4/c1-16-11(18)6-5-10(13(16)19)17-7-15-12-8(14(20)21)3-2-4-9(12)17/h2-4,7,10H,5-6H2,1H3,(H,20,21) |
| InChIKey | HFPCXIALHNYXGH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|