C10H8F2N2O2 — CID 115543983
1-(2,2-difluoroethyl)benzimidazole-4-carboxylic acid (PubChem CID 115543983) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)benzimidazole-4-carboxylic acid.
| Compound Name | 1-(2,2-difluoroethyl)benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115543983 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-(2,2-difluoroethyl)benzimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1ncn2CC(F)F |
| InChI | InChI=1S/C10H8F2N2O2/c11-8(12)4-14-5-13-9-6(10(15)16)2-1-3-7(9)14/h1-3,5,8H,4H2,(H,15,16) |
| InChIKey | PVGCXORSWXCOIN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |