About dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate
dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate (PubChem CID 11554432) has the molecular formula C23H20F2O8
and a molecular weight of 462.40 g/mol. Its IUPAC name is dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate |
| PubChem CID | 11554432 |
| Molecular Formula | C23H20F2O8 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)c2ccc(F)cc2)(c2ccc(F)cc2)OC1(OC)OC |
| InChI | InChI=1S/C23H20F2O8/c1-29-20(27)17-18(21(28)30-2)23(31-3,32-4)33-22(17,14-7-11-16(25)12-8-14)19(26)13-5-9-15(24)10-6-13/h5-12H,1-4H3 |
| InChIKey | XKBZICVJIFKVGZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate?
The IUPAC name of dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate (CID 11554432) is dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate?
The canonical SMILES for dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate is COC(=O)C1=C(C(=O)OC)C(C(=O)c2ccc(F)cc2)(c2ccc(F)cc2)OC1(OC)OC.
What is the InChIKey of dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate?
The InChIKey is XKBZICVJIFKVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2O8/c1-29-20(27)17-18(21(28)30-2)23(31-3,32-4)33-22(17,14-7-11-16(25)12-8-14)19(26)13-5-9-15(24)10-6-13/h5-12H,1-4H3.
What are the key properties of dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate?
dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate has a molecular weight of 462.40 g/mol, XLogP of 2.66, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(4-fluorobenzoyl)-2-(4-fluorophenyl)-5,5-dimethoxyfuran-3,4-dicarboxylate is sourced from PubChem (CID 11554432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).