C14H18N4OS — CID 115545340
2-amino-3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]benzamide (PubChem CID 115545340) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-amino-3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]benzamide.
| Compound Name | 2-amino-3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 115545340 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-amino-3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]benzamide |
| SMILES | Cc1nc(C)c(C(C)Nc2cccc(C(N)=O)c2N)s1 |
| InChI | InChI=1S/C14H18N4OS/c1-7-13(20-9(3)17-7)8(2)18-11-6-4-5-10(12(11)15)14(16)19/h4-6,8,18H,15H2,1-3H3,(H2,16,19) |
| InChIKey | ZYFVCPGJDIHJHB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|