2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid

C11H14N2O3S — CID 115545411

IUPAC2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid
SMILESNc1c(C(=O)O)cccc1N1CCS(=O)CC1
InChIInChI=1S/C11H14N2O3S/c12-10-8(11(14)15)2-1-3-9(10)13-4-6-17(16)7-5-13/h1-3H,4-7,12H2,(H,14,15)
InChIKeyLVRGDDZXXGACAQ-UHFFFAOYSA-N
MW254.31 g/mol
LogP0.54
Rot. Bonds2

About 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid

2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid (PubChem CID 115545411) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid.

Molecular Properties

Compound Name2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid
PubChem CID115545411
Molecular FormulaC11H14N2O3S
Molecular Weight254.31 g/mol
Exact Mass254.07
IUPAC Name2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid
SMILESNc1c(C(=O)O)cccc1N1CCS(=O)CC1
InChIInChI=1S/C11H14N2O3S/c12-10-8(11(14)15)2-1-3-9(10)13-4-6-17(16)7-5-13/h1-3H,4-7,12H2,(H,14,15)
InChIKeyLVRGDDZXXGACAQ-UHFFFAOYSA-N
XLogP0.54
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.31
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
The IUPAC name of 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid (CID 115545411) is 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid.
What is the SMILES notation for 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
The canonical SMILES for 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid is Nc1c(C(=O)O)cccc1N1CCS(=O)CC1.
What is the InChIKey of 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
The InChIKey is LVRGDDZXXGACAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c12-10-8(11(14)15)2-1-3-9(10)13-4-6-17(16)7-5-13/h1-3H,4-7,12H2,(H,14,15).
What are the key properties of 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid has a molecular weight of 254.31 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1-oxo-1,4-thiazinan-4-yl)benzoic acid is sourced from PubChem (CID 115545411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).