C21H24ClF2N3O3S — CID 11554632
2-chloro-N-[(1S)-1-(1-ethylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)ethyl]-3,6-difluorobenzamide (PubChem CID 11554632) has the molecular formula C21H24ClF2N3O3S and a molecular weight of 471.96 g/mol. Its IUPAC name is 2-chloro-N-[(1S)-1-(1-ethylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)ethyl]-3,6-difluorobenzamide.
| Compound Name | 2-chloro-N-[(1S)-1-(1-ethylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)ethyl]-3,6-difluorobenzamide |
|---|---|
| PubChem CID | 11554632 |
| Molecular Formula | C21H24ClF2N3O3S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-chloro-N-[(1S)-1-(1-ethylsulfonyl-4-pyridin-2-ylpiperidin-4-yl)ethyl]-3,6-difluorobenzamide |
| SMILES | CCS(=O)(=O)N1CCC(c2ccccn2)([C@H](C)NC(=O)c2c(F)ccc(F)c2Cl)CC1 |
| InChI | InChI=1S/C21H24ClF2N3O3S/c1-3-31(29,30)27-12-9-21(10-13-27,17-6-4-5-11-25-17)14(2)26-20(28)18-15(23)7-8-16(24)19(18)22/h4-8,11,14H,3,9-10,12-13H2,1-2H3,(H,26,28)/t14-/m0/s1 |
| InChIKey | HIDPBGHZPDCQLC-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|