C29H25N3O2S — CID 11554767
16-N-(4-benzyl-1,3-thiazol-2-yl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide (PubChem CID 11554767) has the molecular formula C29H25N3O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is 16-N-(4-benzyl-1,3-thiazol-2-yl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide.
| Compound Name | 16-N-(4-benzyl-1,3-thiazol-2-yl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide |
|---|---|
| PubChem CID | 11554767 |
| Molecular Formula | C29H25N3O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 16-N-(4-benzyl-1,3-thiazol-2-yl)-16-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-3,16-dicarboxamide |
| SMILES | CC1(C(=O)Nc2nc(Cc3ccccc3)cs2)CC2c3ccccc3C1c1cccc(C(N)=O)c12 |
| InChI | InChI=1S/C29H25N3O2S/c1-29(27(34)32-28-31-18(16-35-28)14-17-8-3-2-4-9-17)15-23-19-10-5-6-11-20(19)25(29)21-12-7-13-22(24(21)23)26(30)33/h2-13,16,23,25H,14-15H2,1H3,(H2,30,33)(H,31,32,34) |
| InChIKey | NTRXSJYHCPYHHO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |