About 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea
1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea (PubChem CID 11554828) has the molecular formula C23H21N3O3S3
and a molecular weight of 483.64 g/mol. Its IUPAC name is 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea.
Molecular Properties
| Compound Name | 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea |
| PubChem CID | 11554828 |
| Molecular Formula | C23H21N3O3S3 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea |
| SMILES | Cc1nc(-c2ccccc2)c(NC(=O)NS(=O)(=O)c2ccc(CCc3ccccc3)s2)s1 |
| InChI | InChI=1S/C23H21N3O3S3/c1-16-24-21(18-10-6-3-7-11-18)22(30-16)25-23(27)26-32(28,29)20-15-14-19(31-20)13-12-17-8-4-2-5-9-17/h2-11,14-15H,12-13H2,1H3,(H2,25,26,27) |
| InChIKey | LCYKFHUDPNFPNG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea?
The IUPAC name of 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea (CID 11554828) is 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea.
What is the SMILES notation for 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea?
The canonical SMILES for 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea is Cc1nc(-c2ccccc2)c(NC(=O)NS(=O)(=O)c2ccc(CCc3ccccc3)s2)s1.
What is the InChIKey of 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea?
The InChIKey is LCYKFHUDPNFPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O3S3/c1-16-24-21(18-10-6-3-7-11-18)22(30-16)25-23(27)26-32(28,29)20-15-14-19(31-20)13-12-17-8-4-2-5-9-17/h2-11,14-15H,12-13H2,1H3,(H2,25,26,27).
What are the key properties of 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea?
1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea has a molecular weight of 483.64 g/mol, XLogP of 5.48, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-4-phenyl-1,3-thiazol-5-yl)-3-[5-(2-phenylethyl)thiophen-2-yl]sulfonylurea is sourced from PubChem (CID 11554828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).