C23H22F3N5O2S — CID 11554929
6-ethoxy-11-(4-methoxyphenyl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 11554929) has the molecular formula C23H22F3N5O2S and a molecular weight of 489.52 g/mol. Its IUPAC name is 6-ethoxy-11-(4-methoxyphenyl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-ethoxy-11-(4-methoxyphenyl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 11554929 |
| Molecular Formula | C23H22F3N5O2S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 6-ethoxy-11-(4-methoxyphenyl)-4-piperazin-1-yl-13-(trifluoromethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(N2CCNCC2)nc2c1sc1nc(-c3ccc(OC)cc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C23H22F3N5O2S/c1-3-33-20-19-18(29-22(30-20)31-10-8-27-9-11-31)17-15(23(24,25)26)12-16(28-21(17)34-19)13-4-6-14(32-2)7-5-13/h4-7,12,27H,3,8-11H2,1-2H3 |
| InChIKey | VNHMPKDJAAONHQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |