About 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea
1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea (PubChem CID 115549872) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea |
| PubChem CID | 115549872 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea |
| SMILES | C#CCN(CC1CC1)C(=O)N(C)C |
| InChI | InChI=1S/C10H16N2O/c1-4-7-12(8-9-5-6-9)10(13)11(2)3/h1,9H,5-8H2,2-3H3 |
| InChIKey | JSDKHIBURSQLCG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea?
The IUPAC name of 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea (CID 115549872) is 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea.
What is the SMILES notation for 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea?
The canonical SMILES for 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea is C#CCN(CC1CC1)C(=O)N(C)C.
What is the InChIKey of 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea?
The InChIKey is JSDKHIBURSQLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-4-7-12(8-9-5-6-9)10(13)11(2)3/h1,9H,5-8H2,2-3H3.
What are the key properties of 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea?
1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea has a molecular weight of 180.25 g/mol, XLogP of 1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-3,3-dimethyl-1-prop-2-ynylurea is sourced from PubChem (CID 115549872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).