C12H18N2O2 — CID 115550175
2-N-(1,4-dioxan-2-ylmethyl)-3-methylbenzene-1,2-diamine (PubChem CID 115550175) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-N-(1,4-dioxan-2-ylmethyl)-3-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(1,4-dioxan-2-ylmethyl)-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115550175 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-N-(1,4-dioxan-2-ylmethyl)-3-methylbenzene-1,2-diamine |
| SMILES | Cc1cccc(N)c1NCC1COCCO1 |
| InChI | InChI=1S/C12H18N2O2/c1-9-3-2-4-11(13)12(9)14-7-10-8-15-5-6-16-10/h2-4,10,14H,5-8,13H2,1H3 |
| InChIKey | OYUGFCZRQMYKNR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|