C12H20N2O — CID 115550688
(2S)-2-(2-amino-6-methylanilino)-3-methylbutan-1-ol (PubChem CID 115550688) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (2S)-2-(2-amino-6-methylanilino)-3-methylbutan-1-ol.
| Compound Name | (2S)-2-(2-amino-6-methylanilino)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 115550688 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (2S)-2-(2-amino-6-methylanilino)-3-methylbutan-1-ol |
| SMILES | Cc1cccc(N)c1N[C@H](CO)C(C)C |
| InChI | InChI=1S/C12H20N2O/c1-8(2)11(7-15)14-12-9(3)5-4-6-10(12)13/h4-6,8,11,14-15H,7,13H2,1-3H3/t11-/m1/s1 |
| InChIKey | WQUUOATVQYYMBI-LLVKDONJSA-N |
| XLogP | 2.01 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|