C30H27N3O5 — CID 11555282
N'-(3-cyano-4-hydroxybenzoyl)-3-[4-[(2,3,5,6-tetramethylphenyl)methoxy]phenyl]furan-2-carbohydrazide (PubChem CID 11555282) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is N'-(3-cyano-4-hydroxybenzoyl)-3-[4-[(2,3,5,6-tetramethylphenyl)methoxy]phenyl]furan-2-carbohydrazide.
| Compound Name | N'-(3-cyano-4-hydroxybenzoyl)-3-[4-[(2,3,5,6-tetramethylphenyl)methoxy]phenyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 11555282 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N'-(3-cyano-4-hydroxybenzoyl)-3-[4-[(2,3,5,6-tetramethylphenyl)methoxy]phenyl]furan-2-carbohydrazide |
| SMILES | Cc1cc(C)c(C)c(COc2ccc(-c3ccoc3C(=O)NNC(=O)c3ccc(O)c(C#N)c3)cc2)c1C |
| InChI | InChI=1S/C30H27N3O5/c1-17-13-18(2)20(4)26(19(17)3)16-38-24-8-5-21(6-9-24)25-11-12-37-28(25)30(36)33-32-29(35)22-7-10-27(34)23(14-22)15-31/h5-14,34H,16H2,1-4H3,(H,32,35)(H,33,36) |
| InChIKey | KWXRQDXNYKALBE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|