C22H16F9NO3 — CID 11555330
1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol (PubChem CID 11555330) has the molecular formula C22H16F9NO3 and a molecular weight of 513.36 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 11555330 |
| Molecular Formula | C22H16F9NO3 |
| Molecular Weight | 513.36 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-methyl-4-[[5-methyl-2-[3-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]methoxy]phenyl]propan-2-ol |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCc1nc(-c2cccc(C(F)(F)F)c2)oc1C |
| InChI | InChI=1S/C22H16F9NO3/c1-11-8-14(19(33,21(26,27)28)22(29,30)31)6-7-17(11)34-10-16-12(2)35-18(32-16)13-4-3-5-15(9-13)20(23,24)25/h3-9,33H,10H2,1-2H3 |
| InChIKey | SSHHNOWTPGGKMX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.36 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |