About 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine
2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine (PubChem CID 115554822) has the molecular formula C12H17ClN2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine |
| PubChem CID | 115554822 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)c(Cl)cc1NC1CC1(C)C |
| InChI | InChI=1S/C12H17ClN2/c1-7-4-9(14)8(13)5-10(7)15-11-6-12(11,2)3/h4-5,11,15H,6,14H2,1-3H3 |
| InChIKey | TTZWPFDEZMPVAK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine?
The IUPAC name of 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine (CID 115554822) is 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine.
What is the SMILES notation for 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine?
The canonical SMILES for 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine is Cc1cc(N)c(Cl)cc1NC1CC1(C)C.
What is the InChIKey of 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine?
The InChIKey is TTZWPFDEZMPVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2/c1-7-4-9(14)8(13)5-10(7)15-11-6-12(11,2)3/h4-5,11,15H,6,14H2,1-3H3.
What are the key properties of 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine?
2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine has a molecular weight of 224.73 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-N-(2,2-dimethylcyclopropyl)-5-methylbenzene-1,4-diamine is sourced from PubChem (CID 115554822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).