C23H28Cl2N4O2S2 — CID 11555517
1-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N,N-diethylpiperidine-4-carboxamide (PubChem CID 11555517) has the molecular formula C23H28Cl2N4O2S2 and a molecular weight of 527.54 g/mol. Its IUPAC name is 1-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N,N-diethylpiperidine-4-carboxamide.
| Compound Name | 1-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N,N-diethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 11555517 |
| Molecular Formula | C23H28Cl2N4O2S2 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 1-[[(E)-1-[5-(3,4-dichlorophenyl)-4-hydroxythiophen-3-yl]ethylideneamino]carbamothioyl]-N,N-diethylpiperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(C(=S)N/N=C(\C)c2csc(-c3ccc(Cl)c(Cl)c3)c2O)CC1 |
| InChI | InChI=1S/C23H28Cl2N4O2S2/c1-4-28(5-2)22(31)15-8-10-29(11-9-15)23(32)27-26-14(3)17-13-33-21(20(17)30)16-6-7-18(24)19(25)12-16/h6-7,12-13,15,30H,4-5,8-11H2,1-3H3,(H,27,32)/b26-14+ |
| InChIKey | JBHDDORUJIEXFR-VULFUBBASA-N |
| XLogP | 5.61 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|