C22H23ClF2N4O3S2 — CID 11555538
3-[[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]-4-methyl-1,3-thiazol-5-yl]methylamino]propanamide (PubChem CID 11555538) has the molecular formula C22H23ClF2N4O3S2 and a molecular weight of 529.03 g/mol. Its IUPAC name is 3-[[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]-4-methyl-1,3-thiazol-5-yl]methylamino]propanamide.
| Compound Name | 3-[[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]-4-methyl-1,3-thiazol-5-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 11555538 |
| Molecular Formula | C22H23ClF2N4O3S2 |
| Molecular Weight | 529.03 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 3-[[2-[1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]-4-methyl-1,3-thiazol-5-yl]methylamino]propanamide |
| SMILES | Cc1nc(C(C)N(c2cc(F)ccc2F)S(=O)(=O)c2ccc(Cl)cc2)sc1CNCCC(N)=O |
| InChI | InChI=1S/C22H23ClF2N4O3S2/c1-13-20(12-27-10-9-21(26)30)33-22(28-13)14(2)29(19-11-16(24)5-8-18(19)25)34(31,32)17-6-3-15(23)4-7-17/h3-8,11,14,27H,9-10,12H2,1-2H3,(H2,26,30) |
| InChIKey | PQVBFVQDRTYGEU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.03 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|