C28H60O5Si2 — CID 11555574
tert-butyl-[(Z,2S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-2-methylundec-6-enoxy]-dimethylsilane (PubChem CID 11555574) has the molecular formula C28H60O5Si2 and a molecular weight of 532.96 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-2-methylundec-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-2-methylundec-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11555574 |
| Molecular Formula | C28H60O5Si2 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.40 |
| IUPAC Name | tert-butyl-[(Z,2S,9S,10S)-10-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-2-methylundec-6-enoxy]-dimethylsilane |
| SMILES | COCCOCO[C@@H](C/C=C\CCC[C@H](C)CO[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H60O5Si2/c1-24(22-32-34(10,11)27(3,4)5)18-16-14-15-17-19-26(31-23-30-21-20-29-9)25(2)33-35(12,13)28(6,7)8/h15,17,24-26H,14,16,18-23H2,1-13H3/b17-15-/t24-,25-,26-/m0/s1 |
| InChIKey | NZMQQIFIKANGFA-BDYIZISRSA-N |
| XLogP | 8.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|