C27H35N7O3S — CID 11555635
5-[3-[2-(diethylamino)ethoxy]phenyl]-N-piperidin-3-yl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carboxamide (PubChem CID 11555635) has the molecular formula C27H35N7O3S and a molecular weight of 537.69 g/mol. Its IUPAC name is 5-[3-[2-(diethylamino)ethoxy]phenyl]-N-piperidin-3-yl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carboxamide.
| Compound Name | 5-[3-[2-(diethylamino)ethoxy]phenyl]-N-piperidin-3-yl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 11555635 |
| Molecular Formula | C27H35N7O3S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 5-[3-[2-(diethylamino)ethoxy]phenyl]-N-piperidin-3-yl-2-(pyrazin-2-ylcarbamoylamino)thiophene-3-carboxamide |
| SMILES | CCN(CC)CCOc1cccc(-c2cc(C(=O)NC3CCCNC3)c(NC(=O)Nc3cnccn3)s2)c1 |
| InChI | InChI=1S/C27H35N7O3S/c1-3-34(4-2)13-14-37-21-9-5-7-19(15-21)23-16-22(25(35)31-20-8-6-10-28-17-20)26(38-23)33-27(36)32-24-18-29-11-12-30-24/h5,7,9,11-12,15-16,18,20,28H,3-4,6,8,10,13-14,17H2,1-2H3,(H,31,35)(H2,30,32,33,36) |
| InChIKey | YNPVDEACDCMHGX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |