C26H26BrN3O5 — CID 11555666
[(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide (PubChem CID 11555666) has the molecular formula C26H26BrN3O5 and a molecular weight of 540.41 g/mol. Its IUPAC name is [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide.
| Compound Name | [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide |
|---|---|
| PubChem CID | 11555666 |
| Molecular Formula | C26H26BrN3O5 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [(3R)-1-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 9-hydroxyfluorene-9-carboxylate bromide |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(O)c3ccccc3-c3ccccc31)C2)Nc1ccon1.[Br-] |
| InChI | InChI=1S/C26H25N3O5.BrH/c30-24(27-23-11-14-33-28-23)16-29-12-9-17(10-13-29)22(15-29)34-25(31)26(32)20-7-3-1-5-18(20)19-6-2-4-8-21(19)26;/h1-8,11,14,17,22,32H,9-10,12-13,15-16H2;1H/t17?,22-,29?;/m0./s1 |
| InChIKey | ZALNUKXLKBGXRZ-YUXMWEGSSA-N |
| XLogP | -0.31 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|