C32H29F2N3O3 — CID 11555682
methyl 2-fluoro-6-[3-fluoro-4-[[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]benzoyl]amino]methyl]phenyl]benzoate (PubChem CID 11555682) has the molecular formula C32H29F2N3O3 and a molecular weight of 541.60 g/mol. Its IUPAC name is methyl 2-fluoro-6-[3-fluoro-4-[[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]benzoyl]amino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-fluoro-6-[3-fluoro-4-[[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]benzoyl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11555682 |
| Molecular Formula | C32H29F2N3O3 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | methyl 2-fluoro-6-[3-fluoro-4-[[[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]benzoyl]amino]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(CNC(=O)c2cccc(CCc3ccc4c(n3)NCCC4)c2)c(F)c1 |
| InChI | InChI=1S/C32H29F2N3O3/c1-40-32(39)29-26(8-3-9-27(29)33)22-11-12-24(28(34)18-22)19-36-31(38)23-6-2-5-20(17-23)10-14-25-15-13-21-7-4-16-35-30(21)37-25/h2-3,5-6,8-9,11-13,15,17-18H,4,7,10,14,16,19H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | VBQJCTZEVKXDGS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |