C8H13F3N2O3 — CID 115556919
4-amino-N-(2,2,2-trifluoroethoxy)oxane-4-carboxamide (PubChem CID 115556919) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is 4-amino-N-(2,2,2-trifluoroethoxy)oxane-4-carboxamide.
| Compound Name | 4-amino-N-(2,2,2-trifluoroethoxy)oxane-4-carboxamide |
|---|---|
| PubChem CID | 115556919 |
| Molecular Formula | C8H13F3N2O3 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-amino-N-(2,2,2-trifluoroethoxy)oxane-4-carboxamide |
| SMILES | NC1(C(=O)NOCC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C8H13F3N2O3/c9-8(10,11)5-16-13-6(14)7(12)1-3-15-4-2-7/h1-5,12H2,(H,13,14) |
| InChIKey | NKMYNQGYNVZKPM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|