C27H29BrNO+ — CID 11555705
[1-[(3-bromophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol (PubChem CID 11555705) has the molecular formula C27H29BrNO+ and a molecular weight of 463.44 g/mol. Its IUPAC name is [1-[(3-bromophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol.
| Compound Name | [1-[(3-bromophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 11555705 |
| Molecular Formula | C27H29BrNO+ |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [1-[(3-bromophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C12CC[N+](Cc3cccc(Br)c3)(CC1)CC2 |
| InChI | InChI=1S/C27H29BrNO/c28-25-13-7-8-22(20-25)21-29-17-14-26(15-18-29,16-19-29)27(30,23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-13,20,30H,14-19,21H2/q+1 |
| InChIKey | JFQHJEQWTWUCLF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|