C13H19BrN2 — CID 115557165
2-bromo-5-[[cyclobutylmethyl(methyl)amino]methyl]aniline (PubChem CID 115557165) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-bromo-5-[[cyclobutylmethyl(methyl)amino]methyl]aniline.
| Compound Name | 2-bromo-5-[[cyclobutylmethyl(methyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 115557165 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-bromo-5-[[cyclobutylmethyl(methyl)amino]methyl]aniline |
| SMILES | CN(Cc1ccc(Br)c(N)c1)CC1CCC1 |
| InChI | InChI=1S/C13H19BrN2/c1-16(8-10-3-2-4-10)9-11-5-6-12(14)13(15)7-11/h5-7,10H,2-4,8-9,15H2,1H3 |
| InChIKey | YTOOIPRDRYOPKF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|