C15H22BrN3 — CID 115557190
2-bromo-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]aniline (PubChem CID 115557190) has the molecular formula C15H22BrN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 2-bromo-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]aniline.
| Compound Name | 2-bromo-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 115557190 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-bromo-5-[(3-pyrrolidin-1-ylpyrrolidin-1-yl)methyl]aniline |
| SMILES | Nc1cc(CN2CCC(N3CCCC3)C2)ccc1Br |
| InChI | InChI=1S/C15H22BrN3/c16-14-4-3-12(9-15(14)17)10-18-8-5-13(11-18)19-6-1-2-7-19/h3-4,9,13H,1-2,5-8,10-11,17H2 |
| InChIKey | FCILCEZPYPWXCC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|