C16H16BrNO3 — CID 115558024
2-[(4-bromo-3-nitrophenyl)methoxy]-1,3,4-trimethylbenzene (PubChem CID 115558024) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-[(4-bromo-3-nitrophenyl)methoxy]-1,3,4-trimethylbenzene.
| Compound Name | 2-[(4-bromo-3-nitrophenyl)methoxy]-1,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 115558024 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[(4-bromo-3-nitrophenyl)methoxy]-1,3,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(OCc2ccc(Br)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C16H16BrNO3/c1-10-4-5-11(2)16(12(10)3)21-9-13-6-7-14(17)15(8-13)18(19)20/h4-8H,9H2,1-3H3 |
| InChIKey | KRIZGEQXJQUWBD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|