C10H8BrN3O2S2 — CID 115558308
5-[(4-bromo-3-nitrophenyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole (PubChem CID 115558308) has the molecular formula C10H8BrN3O2S2 and a molecular weight of 346.23 g/mol. Its IUPAC name is 5-[(4-bromo-3-nitrophenyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-[(4-bromo-3-nitrophenyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 115558308 |
| Molecular Formula | C10H8BrN3O2S2 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | 5-[(4-bromo-3-nitrophenyl)methylsulfanyl]-3-methyl-1,2,4-thiadiazole |
| SMILES | Cc1nsc(SCc2ccc(Br)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C10H8BrN3O2S2/c1-6-12-10(18-13-6)17-5-7-2-3-8(11)9(4-7)14(15)16/h2-4H,5H2,1H3 |
| InChIKey | JEJVUXVINBDVJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|