C16H23FN2O — CID 115558909
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 115558909) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 115558909 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(N2CC3CCCC3C2)c(N)cc1F |
| InChI | InChI=1S/C16H23FN2O/c1-10(2)20-16-7-15(14(18)6-13(16)17)19-8-11-4-3-5-12(11)9-19/h6-7,10-12H,3-5,8-9,18H2,1-2H3 |
| InChIKey | FGOUAVPFDQINAW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|