C17H26N2O — CID 115559129
[3-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]methanamine (PubChem CID 115559129) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is [3-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]methanamine.
| Compound Name | [3-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 115559129 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | [3-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]methanamine |
| SMILES | NCc1cccc(OCCCN2CC3CCCC3C2)c1 |
| InChI | InChI=1S/C17H26N2O/c18-11-14-4-1-7-17(10-14)20-9-3-8-19-12-15-5-2-6-16(15)13-19/h1,4,7,10,15-16H,2-3,5-6,8-9,11-13,18H2 |
| InChIKey | KZNQAVQMIQEEGY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|