C14H25N3 — CID 115560245
N'-cyclohexyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide (PubChem CID 115560245) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N'-cyclohexyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide.
| Compound Name | N'-cyclohexyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide |
|---|---|
| PubChem CID | 115560245 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N'-cyclohexyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboximidamide |
| SMILES | N/C(=N\C1CCCCC1)N1CC2CCCC2C1 |
| InChI | InChI=1S/C14H25N3/c15-14(16-13-7-2-1-3-8-13)17-9-11-5-4-6-12(11)10-17/h11-13H,1-10H2,(H2,15,16) |
| InChIKey | CIXGAYQOXZMHER-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|