C9H15NO — CID 115560602
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)acetaldehyde (PubChem CID 115560602) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)acetaldehyde.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 115560602 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)acetaldehyde |
| SMILES | O=CCN1CC2CCCC2C1 |
| InChI | InChI=1S/C9H15NO/c11-5-4-10-6-8-2-1-3-9(8)7-10/h5,8-9H,1-4,6-7H2 |
| InChIKey | BXMYCYYVBTTWKN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|