C10H12Cl2N4 — CID 115561016
2-(4,6-dichloro-1,3,5-triazin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 115561016) has the molecular formula C10H12Cl2N4 and a molecular weight of 259.14 g/mol. Its IUPAC name is 2-(4,6-dichloro-1,3,5-triazin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-(4,6-dichloro-1,3,5-triazin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 115561016 |
| Molecular Formula | C10H12Cl2N4 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-(4,6-dichloro-1,3,5-triazin-2-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Clc1nc(Cl)nc(N2CC3CCCC3C2)n1 |
| InChI | InChI=1S/C10H12Cl2N4/c11-8-13-9(12)15-10(14-8)16-4-6-2-1-3-7(6)5-16/h6-7H,1-5H2 |
| InChIKey | QNIGTZAPCQXDLB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |