C14H17FN2O2 — CID 115561183
5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-amino-4-fluorobenzoic acid (PubChem CID 115561183) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-amino-4-fluorobenzoic acid.
| Compound Name | 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-amino-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 115561183 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 5-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-2-amino-4-fluorobenzoic acid |
| SMILES | Nc1cc(F)c(N2CC3CCCC3C2)cc1C(=O)O |
| InChI | InChI=1S/C14H17FN2O2/c15-11-5-12(16)10(14(18)19)4-13(11)17-6-8-2-1-3-9(8)7-17/h4-5,8-9H,1-3,6-7,16H2,(H,18,19) |
| InChIKey | TYFDXTGXWXUSPH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|