C16H29NO2 — CID 115562015
4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-2,2,5,5-tetramethyloxolan-3-ol (PubChem CID 115562015) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-2,2,5,5-tetramethyloxolan-3-ol.
| Compound Name | 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-2,2,5,5-tetramethyloxolan-3-ol |
|---|---|
| PubChem CID | 115562015 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-2,2,5,5-tetramethyloxolan-3-ol |
| SMILES | CC1(C)OC(C)(C)C(CN2CC3CCCC3C2)C1O |
| InChI | InChI=1S/C16H29NO2/c1-15(2)13(14(18)16(3,4)19-15)10-17-8-11-6-5-7-12(11)9-17/h11-14,18H,5-10H2,1-4H3 |
| InChIKey | BLHYBKJLWATHTG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |