C16H29NO — CID 115562041
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-3,5-dimethylcyclohexan-1-ol (PubChem CID 115562041) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-3,5-dimethylcyclohexan-1-ol.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-3,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 115562041 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)-3,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)C(CN2CC3CCCC3C2)C(O)C1 |
| InChI | InChI=1S/C16H29NO/c1-11-6-12(2)15(16(18)7-11)10-17-8-13-4-3-5-14(13)9-17/h11-16,18H,3-10H2,1-2H3 |
| InChIKey | PYVBDXZJIUAWMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |