C17H18N2OS — CID 115562425
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazole-5-carbaldehyde (PubChem CID 115562425) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 115562425 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-phenyl-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(N2CC3CCCC3C2)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H18N2OS/c20-11-15-16(12-5-2-1-3-6-12)18-17(21-15)19-9-13-7-4-8-14(13)10-19/h1-3,5-6,11,13-14H,4,7-10H2 |
| InChIKey | AUNSYJIBHWSONZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|