C15H25N3S — CID 115562464
1-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]-N-methylmethanamine (PubChem CID 115562464) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 115562464 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-4-propan-2-yl-1,3-thiazol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1sc(N2CC3CCCC3C2)nc1C(C)C |
| InChI | InChI=1S/C15H25N3S/c1-10(2)14-13(7-16-3)19-15(17-14)18-8-11-5-4-6-12(11)9-18/h10-12,16H,4-9H2,1-3H3 |
| InChIKey | XWXMIWCAPVJLAI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |