C14H19N7 — CID 115563016
4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine (PubChem CID 115563016) has the molecular formula C14H19N7 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115563016 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(N2CC3CCCC3C2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C14H19N7/c1-15-12-17-13(20-6-5-16-9-20)19-14(18-12)21-7-10-3-2-4-11(10)8-21/h5-6,9-11H,2-4,7-8H2,1H3,(H,15,17,18,19) |
| InChIKey | OFFUELBZNJUNTC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |