C23H16BrCl2F2N2O3PS — CID 11556324
[[2-bromo-4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 11556324) has the molecular formula C23H16BrCl2F2N2O3PS and a molecular weight of 620.24 g/mol. Its IUPAC name is [[2-bromo-4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-bromo-4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11556324 |
| Molecular Formula | C23H16BrCl2F2N2O3PS |
| Molecular Weight | 620.24 g/mol |
| Exact Mass | 617.91 |
| IUPAC Name | [[2-bromo-4-[(3,4-dichloro-N-(4-phenyl-1,3-thiazol-2-yl)anilino)methyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)(F)c1ccc(CN(c2ccc(Cl)c(Cl)c2)c2nc(-c3ccccc3)cs2)cc1Br |
| InChI | InChI=1S/C23H16BrCl2F2N2O3PS/c24-18-10-14(6-8-17(18)23(27,28)34(31,32)33)12-30(16-7-9-19(25)20(26)11-16)22-29-21(13-35-22)15-4-2-1-3-5-15/h1-11,13H,12H2,(H2,31,32,33) |
| InChIKey | BZQLZUYFAXLVNE-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.24 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|