C27H24BrF2N2O6P — CID 11556336
[[4-[[3-benzyl-5-(4-ethoxycarbonylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid (PubChem CID 11556336) has the molecular formula C27H24BrF2N2O6P and a molecular weight of 621.37 g/mol. Its IUPAC name is [[4-[[3-benzyl-5-(4-ethoxycarbonylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[[3-benzyl-5-(4-ethoxycarbonylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11556336 |
| Molecular Formula | C27H24BrF2N2O6P |
| Molecular Weight | 621.37 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | [[4-[[3-benzyl-5-(4-ethoxycarbonylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
| SMILES | CCOC(=O)c1ccc(-c2cn(Cc3ccccc3)c(=O)n2Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H24BrF2N2O6P/c1-2-38-25(33)21-11-9-20(10-12-21)24-17-31(15-18-6-4-3-5-7-18)26(34)32(24)16-19-8-13-22(23(28)14-19)27(29,30)39(35,36)37/h3-14,17H,2,15-16H2,1H3,(H2,35,36,37) |
| InChIKey | UJKAUPAUBWHXRH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|