C11H20N4O — CID 115563730
2,2-dimethyl-N-[(1-methyltriazol-4-yl)methyl]oxan-4-amine (PubChem CID 115563730) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(1-methyltriazol-4-yl)methyl]oxan-4-amine.
| Compound Name | 2,2-dimethyl-N-[(1-methyltriazol-4-yl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 115563730 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,2-dimethyl-N-[(1-methyltriazol-4-yl)methyl]oxan-4-amine |
| SMILES | Cn1cc(CNC2CCOC(C)(C)C2)nn1 |
| InChI | InChI=1S/C11H20N4O/c1-11(2)6-9(4-5-16-11)12-7-10-8-15(3)14-13-10/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | QVJGTLRTOMLCSV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |